C16H21N3O3S — CID 5267780
N,N-diethyl-6-(2-methoxyanilino)pyridine-3-sulfonamide (PubChem CID 5267780) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N,N-diethyl-6-(2-methoxyanilino)pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-(2-methoxyanilino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267780 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N,N-diethyl-6-(2-methoxyanilino)pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ccccc2OC)nc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-4-19(5-2)23(20,21)13-10-11-16(17-12-13)18-14-8-6-7-9-15(14)22-3/h6-12H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | IWCZVHYJOGSQNF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |