C15H19N3O3S — CID 5267586
6-(2-methoxy-5-methylanilino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 5267586) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 6-(2-methoxy-5-methylanilino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(2-methoxy-5-methylanilino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267586 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 6-(2-methoxy-5-methylanilino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | COc1ccc(C)cc1Nc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C15H19N3O3S/c1-11-5-7-14(21-4)13(9-11)17-15-8-6-12(10-16-15)22(19,20)18(2)3/h5-10H,1-4H3,(H,16,17) |
| InChIKey | ILLVNJAYDFNMOZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |