C13H13Cl2N3O2S — CID 5267654
6-(2,5-dichloroanilino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 5267654) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is 6-(2,5-dichloroanilino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(2,5-dichloroanilino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267654 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 6-(2,5-dichloroanilino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Nc2cc(Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C13H13Cl2N3O2S/c1-18(2)21(19,20)10-4-6-13(16-8-10)17-12-7-9(14)3-5-11(12)15/h3-8H,1-2H3,(H,16,17) |
| InChIKey | ZZENELSSKFULBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |