C16H18ClN3O2S — CID 5268142
N-(4-chloro-2-methylphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 5268142) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-(4-chloro-2-methylphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 5268142 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | Cc1cc(Cl)ccc1Nc1ccc(S(=O)(=O)N2CCCC2)cn1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-12-10-13(17)4-6-15(12)19-16-7-5-14(11-18-16)23(21,22)20-8-2-3-9-20/h4-7,10-11H,2-3,8-9H2,1H3,(H,18,19) |
| InChIKey | DUPFCZGFAWKZDM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |