C17H21N3O3S — CID 5268213
N-(4-ethoxyphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 5268213) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 5268213 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | CCOc1ccc(Nc2ccc(S(=O)(=O)N3CCCC3)cn2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-23-15-7-5-14(6-8-15)19-17-10-9-16(13-18-17)24(21,22)20-11-3-4-12-20/h5-10,13H,2-4,11-12H2,1H3,(H,18,19) |
| InChIKey | PPEHPVTUUHDAQY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |