C20H24N2O4S2 — CID 38969543
1-(4-ethoxyphenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone (PubChem CID 38969543) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone.
| Compound Name | 1-(4-ethoxyphenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 38969543 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
| SMILES | CCOc1ccc(C(=O)CSc2ccc(S(=O)(=O)N3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-2-26-17-8-6-16(7-9-17)19(23)15-27-20-11-10-18(14-21-20)28(24,25)22-12-4-3-5-13-22/h6-11,14H,2-5,12-13,15H2,1H3 |
| InChIKey | OLAQOXCAJFCOMT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |