C18H20N2O4S2 — CID 38976708
1-(2-methoxyphenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone (PubChem CID 38976708) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone.
| Compound Name | 1-(2-methoxyphenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 38976708 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]ethanone |
| SMILES | COc1ccccc1C(=O)CSc1ccc(S(=O)(=O)N2CCCC2)cn1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-24-17-7-3-2-6-15(17)16(21)13-25-18-9-8-14(12-19-18)26(22,23)20-10-4-5-11-20/h2-3,6-9,12H,4-5,10-11,13H2,1H3 |
| InChIKey | VATYFIVLYDXBHH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |