C15H21N3O5S2 — CID 7561709
methyl 2-[[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetyl]amino]acetate (PubChem CID 7561709) has the molecular formula C15H21N3O5S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 2-[[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 7561709 |
| Molecular Formula | C15H21N3O5S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 2-[[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CSc1ccc(S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C15H21N3O5S2/c1-23-15(20)10-16-13(19)11-24-14-6-5-12(9-17-14)25(21,22)18-7-3-2-4-8-18/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,16,19) |
| InChIKey | WXMRWYIBTSJHNP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |