C23H32N4O3S2 — CID 24580145
2-[[5-(azepan-1-ylsulfonyl)-2-pyridinyl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 24580145) has the molecular formula C23H32N4O3S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2-[[5-(azepan-1-ylsulfonyl)-2-pyridinyl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[[5-(azepan-1-ylsulfonyl)-2-pyridinyl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 24580145 |
| Molecular Formula | C23H32N4O3S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[[5-(azepan-1-ylsulfonyl)-2-pyridinyl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CN(CCCNC(=O)CSc1ccc(S(=O)(=O)N2CCCCCC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H32N4O3S2/c1-26(20-10-5-4-6-11-20)15-9-14-24-22(28)19-31-23-13-12-21(18-25-23)32(29,30)27-16-7-2-3-8-17-27/h4-6,10-13,18H,2-3,7-9,14-17,19H2,1H3,(H,24,28) |
| InChIKey | LAYDSYBMRLLPJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|