C23H31N3O3S2 — CID 43029124
N-(3-methyl-1-phenylbutyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 43029124) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 43029124 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | CC(C)CC(NC(=O)CSc1ccc(S(=O)(=O)N2CCCCC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-18(2)15-21(19-9-5-3-6-10-19)25-22(27)17-30-23-12-11-20(16-24-23)31(28,29)26-13-7-4-8-14-26/h3,5-6,9-12,16,18,21H,4,7-8,13-15,17H2,1-2H3,(H,25,27) |
| InChIKey | RRHVYKKRDMGBAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |