C22H27ClN2O3S — CID 92681418
2-chloro-N-[(1R)-3-methyl-1-phenylbutyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 92681418) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-3-methyl-1-phenylbutyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[(1R)-3-methyl-1-phenylbutyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 92681418 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-chloro-N-[(1R)-3-methyl-1-phenylbutyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN2O3S/c1-16(2)14-21(17-8-4-3-5-9-17)24-22(26)19-15-18(10-11-20(19)23)29(27,28)25-12-6-7-13-25/h3-5,8-11,15-16,21H,6-7,12-14H2,1-2H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | RIGZJBYQTMXWSA-OAQYLSRUSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |