C25H33ClN2O4S — CID 46763173
5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide (PubChem CID 46763173) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 46763173 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
| SMILES | COc1ccc(C(CC(C)C)NC(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H33ClN2O4S/c1-18(2)16-24(19-8-10-20(32-3)11-9-19)27-25(29)22-17-21(12-13-23(22)26)33(30,31)28-14-6-4-5-7-15-28/h8-13,17-18,24H,4-7,14-16H2,1-3H3,(H,27,29) |
| InChIKey | RMWOFEISEZWRRY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |