C26H36N2O5S — CID 30382454
5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]benzamide (PubChem CID 30382454) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 30382454 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NC(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C26H36N2O5S/c1-19(2)17-24(20-9-11-21(32-3)12-10-20)27-26(29)23-18-22(13-14-25(23)33-4)34(30,31)28-15-7-5-6-8-16-28/h9-14,18-19,24H,5-8,15-17H2,1-4H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | NRLRYGWHIKLBAR-XMMPIXPASA-N |
| XLogP | 4.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |