C26H28N2O4S — CID 43908141
2-methoxy-N-[(4-methylphenyl)-phenylmethyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 43908141) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 2-methoxy-N-[(4-methylphenyl)-phenylmethyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-N-[(4-methylphenyl)-phenylmethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43908141 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-methoxy-N-[(4-methylphenyl)-phenylmethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1C(=O)NC(c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H28N2O4S/c1-19-10-12-21(13-11-19)25(20-8-4-3-5-9-20)27-26(29)23-18-22(14-15-24(23)32-2)33(30,31)28-16-6-7-17-28/h3-5,8-15,18,25H,6-7,16-17H2,1-2H3,(H,27,29) |
| InChIKey | VWADMBUGTGSOFT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |