C24H27N3O3S2 — CID 46608825
N-(1-naphthalen-1-ylethyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 46608825) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46608825 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | CC(NC(=O)CSc1ccc(S(=O)(=O)N2CCCCC2)cn1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27N3O3S2/c1-18(21-11-7-9-19-8-3-4-10-22(19)21)26-23(28)17-31-24-13-12-20(16-25-24)32(29,30)27-14-5-2-6-15-27/h3-4,7-13,16,18H,2,5-6,14-15,17H2,1H3,(H,26,28) |
| InChIKey | LCQHDOZFRNCOAF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |