C17H22N4O4S2 — CID 31580125
4-methyl-N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide (PubChem CID 31580125) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-methyl-N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide.
| Compound Name | 4-methyl-N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 31580125 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-methyl-N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ccc(S(=O)(=O)N3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C17H22N4O4S2/c1-14-5-7-15(8-6-14)26(22,23)20-19-17-10-9-16(13-18-17)27(24,25)21-11-3-2-4-12-21/h5-10,13,20H,2-4,11-12H2,1H3,(H,18,19) |
| InChIKey | SCUOAENGZJVTCZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|