C16H20N4O4S2 — CID 31580113
N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide (PubChem CID 31580113) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide.
| Compound Name | N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 31580113 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-(5-piperidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
| SMILES | O=S(=O)(NNc1ccc(S(=O)(=O)N2CCCCC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O4S2/c21-25(22,14-7-3-1-4-8-14)19-18-16-10-9-15(13-17-16)26(23,24)20-11-5-2-6-12-20/h1,3-4,7-10,13,19H,2,5-6,11-12H2,(H,17,18) |
| InChIKey | DFMQDYUMFLVRHJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|