C15H17FN4O4S2 — CID 39338201
4-fluoro-N'-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide (PubChem CID 39338201) has the molecular formula C15H17FN4O4S2 and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-fluoro-N'-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide.
| Compound Name | 4-fluoro-N'-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 39338201 |
| Molecular Formula | C15H17FN4O4S2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-fluoro-N'-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)benzenesulfonohydrazide |
| SMILES | O=S(=O)(NNc1ccc(S(=O)(=O)N2CCCC2)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN4O4S2/c16-12-3-5-13(6-4-12)25(21,22)19-18-15-8-7-14(11-17-15)26(23,24)20-9-1-2-10-20/h3-8,11,19H,1-2,9-10H2,(H,17,18) |
| InChIKey | APFCAZZASONKGF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|