C13H12Cl2N2O3S2 — CID 6503075
N-(2,5-dichlorophenyl)-4-(dimethylsulfamoyl)thiophene-2-carboxamide (PubChem CID 6503075) has the molecular formula C13H12Cl2N2O3S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(dimethylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(dimethylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503075 |
| Molecular Formula | C13H12Cl2N2O3S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(dimethylsulfamoyl)thiophene-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1csc(C(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O3S2/c1-17(2)22(19,20)9-6-12(21-7-9)13(18)16-11-5-8(14)3-4-10(11)15/h3-7H,1-2H3,(H,16,18) |
| InChIKey | JJVAFCRCBITMFV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |