C14H16N2O4S2 — CID 6503102
4-(dimethylsulfamoyl)-N-(2-hydroxy-5-methylphenyl)thiophene-2-carboxamide (PubChem CID 6503102) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(2-hydroxy-5-methylphenyl)thiophene-2-carboxamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(2-hydroxy-5-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503102 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(2-hydroxy-5-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2cc(S(=O)(=O)N(C)C)cs2)c1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-9-4-5-12(17)11(6-9)15-14(18)13-7-10(8-21-13)22(19,20)16(2)3/h4-8,17H,1-3H3,(H,15,18) |
| InChIKey | CKCKAPOPHQQSHA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|