C15H18N2O4S2 — CID 6503203
4-(diethylsulfamoyl)-N-(2-hydroxyphenyl)thiophene-2-carboxamide (PubChem CID 6503203) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-(2-hydroxyphenyl)thiophene-2-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-N-(2-hydroxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503203 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-(2-hydroxyphenyl)thiophene-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1csc(C(=O)Nc2ccccc2O)c1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-3-17(4-2)23(20,21)11-9-14(22-10-11)15(19)16-12-7-5-6-8-13(12)18/h5-10,18H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | XFCSABMHEBSJBK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|