C16H17N2O5S2- — CID 6968672
2-[[4-(diethylsulfamoyl)thiophene-2-carbonyl]amino]benzoate (PubChem CID 6968672) has the molecular formula C16H17N2O5S2- and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[[4-(diethylsulfamoyl)thiophene-2-carbonyl]amino]benzoate.
| Compound Name | 2-[[4-(diethylsulfamoyl)thiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6968672 |
| Molecular Formula | C16H17N2O5S2- |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[[4-(diethylsulfamoyl)thiophene-2-carbonyl]amino]benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1csc(C(=O)Nc2ccccc2C(=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-3-18(4-2)25(22,23)11-9-14(24-10-11)15(19)17-13-8-6-5-7-12(13)16(20)21/h5-10H,3-4H2,1-2H3,(H,17,19)(H,20,21)/p-1 |
| InChIKey | RQANCGWWLBZBFD-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |