C12H15N3O3S3 — CID 6503193
4-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 6503193) has the molecular formula C12H15N3O3S3 and a molecular weight of 345.47 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503193 |
| Molecular Formula | C12H15N3O3S3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1csc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C12H15N3O3S3/c1-3-15(4-2)21(17,18)9-7-10(20-8-9)11(16)14-12-13-5-6-19-12/h5-8H,3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | VZJJNDHICFIXOX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |