C12H8N2OS3 — CID 71690073
N-(1,3-thiazol-2-yl)-4-thiophen-2-ylthiophene-2-carboxamide (PubChem CID 71690073) has the molecular formula C12H8N2OS3 and a molecular weight of 292.41 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-4-thiophen-2-ylthiophene-2-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)-4-thiophen-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71690073 |
| Molecular Formula | C12H8N2OS3 |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-4-thiophen-2-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C12H8N2OS3/c15-11(14-12-13-3-5-17-12)10-6-8(7-18-10)9-2-1-4-16-9/h1-7H,(H,13,14,15) |
| InChIKey | KPVTXKOUSCHSMI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |