C12H13NO2S2 — CID 71690068
N-(2-methoxyethyl)-4-thiophen-2-ylthiophene-2-carboxamide (PubChem CID 71690068) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-thiophen-2-ylthiophene-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-thiophen-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71690068 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-(2-methoxyethyl)-4-thiophen-2-ylthiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C12H13NO2S2/c1-15-5-4-13-12(14)11-7-9(8-17-11)10-3-2-6-16-10/h2-3,6-8H,4-5H2,1H3,(H,13,14) |
| InChIKey | MNDHSYNSBBGEJF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|