C16H20N2O2S2 — CID 71690078
N-(3-morpholin-4-ylpropyl)-4-thiophen-2-ylthiophene-2-carboxamide (PubChem CID 71690078) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-thiophen-2-ylthiophene-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-thiophen-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71690078 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-thiophen-2-ylthiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H20N2O2S2/c19-16(17-4-2-5-18-6-8-20-9-7-18)15-11-13(12-22-15)14-3-1-10-21-14/h1,3,10-12H,2,4-9H2,(H,17,19) |
| InChIKey | LGFPWQKNYGCNPL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|