C14H24N2O2SSn — CID 23063748
N-(2-morpholin-4-ylethyl)-4-trimethylstannylthiophene-2-carboxamide (PubChem CID 23063748) has the molecular formula C14H24N2O2SSn and a molecular weight of 403.14 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-trimethylstannylthiophene-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-4-trimethylstannylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 23063748 |
| Molecular Formula | C14H24N2O2SSn |
| Molecular Weight | 403.14 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-trimethylstannylthiophene-2-carboxamide |
| SMILES | C[Sn](C)(C)c1csc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C11H15N2O2S.3CH3.Sn/c14-11(10-2-1-9-16-10)12-3-4-13-5-7-15-8-6-13;;;;/h2,9H,3-8H2,(H,12,14);3*1H3; |
| InChIKey | HFBJBPCGYYAPNZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |