C18H21N5O2S — CID 19416688
N-(3-morpholin-4-ylpropyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416688) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416688 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cnn2c(-c3cccs3)ccnc12 |
| InChI | InChI=1S/C18H21N5O2S/c24-18(20-5-2-7-22-8-10-25-11-9-22)14-13-21-23-15(4-6-19-17(14)23)16-3-1-12-26-16/h1,3-4,6,12-13H,2,5,7-11H2,(H,20,24) |
| InChIKey | CLHFNNONEZCPEN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|