C24H25N5O2S — CID 10433757
N-(3-morpholin-4-ylpropyl)-4-(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)thiophene-2-carboxamide (PubChem CID 10433757) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)thiophene-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10433757 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(-c2cnc3c(-c4ccccc4)cnn3c2)cs1 |
| InChI | InChI=1S/C24H25N5O2S/c30-24(25-7-4-8-28-9-11-31-12-10-28)22-13-19(17-32-22)20-14-26-23-21(15-27-29(23)16-20)18-5-2-1-3-6-18/h1-3,5-6,13-17H,4,7-12H2,(H,25,30) |
| InChIKey | DYYUVYPXAYGQFQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|