C21H28N4O3S — CID 95856416
5-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 95856416) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 5-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | 5-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 95856416 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 5-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(-c2ccccn2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C21H28N4O3S/c26-20(23-6-3-7-24-8-12-27-13-9-24)19-16-17(18-4-1-2-5-22-18)21(29-19)25-10-14-28-15-11-25/h1-2,4-5,16H,3,6-15H2,(H,23,26) |
| InChIKey | BCWSBZSNLPUTLZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|