C17H26N4O3 — CID 84573956
6-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide (PubChem CID 84573956) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 6-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide.
| Compound Name | 6-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84573956 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 6-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H26N4O3/c22-17(18-5-2-6-20-7-11-23-12-8-20)15-3-1-4-16(19-15)21-9-13-24-14-10-21/h1,3-4H,2,5-14H2,(H,18,22) |
| InChIKey | HDCAZNNQRYUVBG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|