C24H26N4O4S — CID 19815917
2-methyl-N-(3-morpholin-4-ylpropyl)-4-(4-nitrophenyl)-6-thiophen-2-ylpyridine-3-carboxamide (PubChem CID 19815917) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-methyl-N-(3-morpholin-4-ylpropyl)-4-(4-nitrophenyl)-6-thiophen-2-ylpyridine-3-carboxamide.
| Compound Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-4-(4-nitrophenyl)-6-thiophen-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 19815917 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-4-(4-nitrophenyl)-6-thiophen-2-ylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccs2)cc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26N4O4S/c1-17-23(24(29)25-9-3-10-27-11-13-32-14-12-27)20(16-21(26-17)22-4-2-15-33-22)18-5-7-19(8-6-18)28(30)31/h2,4-8,15-16H,3,9-14H2,1H3,(H,25,29) |
| InChIKey | MCVZOUJGZKMIEU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|