C14H15NOS2 — CID 71690066
N-cyclopentyl-4-thiophen-2-ylthiophene-2-carboxamide (PubChem CID 71690066) has the molecular formula C14H15NOS2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-cyclopentyl-4-thiophen-2-ylthiophene-2-carboxamide.
| Compound Name | N-cyclopentyl-4-thiophen-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71690066 |
| Molecular Formula | C14H15NOS2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-cyclopentyl-4-thiophen-2-ylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C14H15NOS2/c16-14(15-11-4-1-2-5-11)13-8-10(9-18-13)12-6-3-7-17-12/h3,6-9,11H,1-2,4-5H2,(H,15,16) |
| InChIKey | FRIBONHQWHILKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |