C7H5N3OS2 — CID 130841000
N-(1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 130841000) has the molecular formula C7H5N3OS2 and a molecular weight of 211.27 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130841000 |
| Molecular Formula | C7H5N3OS2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cncs1 |
| InChI | InChI=1S/C7H5N3OS2/c11-6(5-3-8-4-13-5)10-7-9-1-2-12-7/h1-4H,(H,9,10,11) |
| InChIKey | GLLXJGCACOVOOW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |