C8H6N4O2S2 — CID 139226744
N'-(1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 139226744) has the molecular formula C8H6N4O2S2 and a molecular weight of 254.30 g/mol. Its IUPAC name is N'-(1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 139226744 |
| Molecular Formula | C8H6N4O2S2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | N'-(1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cncs1)c1cncs1 |
| InChI | InChI=1S/C8H6N4O2S2/c13-7(5-1-9-3-15-5)11-12-8(14)6-2-10-4-16-6/h1-4H,(H,11,13)(H,12,14) |
| InChIKey | NNNHOWCYYLIQOT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|