C7H10N2OS — CID 23525711
N-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 23525711) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is N-propan-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-propan-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 23525711 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | N-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)NC(=O)c1cncs1 |
| InChI | InChI=1S/C7H10N2OS/c1-5(2)9-7(10)6-3-8-4-11-6/h3-5H,1-2H3,(H,9,10) |
| InChIKey | SDNRIKMMPVLPTO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |