C9H15N3OS — CID 103931770
N-[2-(propan-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 103931770) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-[2-(propan-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(propan-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103931770 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-[2-(propan-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)NCCNC(=O)c1cncs1 |
| InChI | InChI=1S/C9H15N3OS/c1-7(2)11-3-4-12-9(13)8-5-10-6-14-8/h5-7,11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | VIANVWCBDDYBHT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|