C8H12N2OS — CID 110848421
N-butan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 110848421) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is N-butan-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-butan-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110848421 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-butan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCC(C)NC(=O)c1cncs1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-6(2)10-8(11)7-4-9-5-12-7/h4-6H,3H2,1-2H3,(H,10,11) |
| InChIKey | QTBGYSUHPBARNZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |