C8H12N2O2S — CID 103920352
N-[(2R)-1-hydroxybutan-2-yl]-1,3-thiazole-5-carboxamide (PubChem CID 103920352) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103920352 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-1,3-thiazole-5-carboxamide |
| SMILES | CC[C@H](CO)NC(=O)c1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-6(4-11)10-8(12)7-3-9-5-13-7/h3,5-6,11H,2,4H2,1H3,(H,10,12)/t6-/m1/s1 |
| InChIKey | ZWIVDBNWSWTGOH-ZCFIWIBFSA-N |
| XLogP | 0.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |