C13H13ClN2OS — CID 114031419
N-(1-chloro-3-phenylpropan-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 114031419) has the molecular formula C13H13ClN2OS and a molecular weight of 280.78 g/mol. Its IUPAC name is N-(1-chloro-3-phenylpropan-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-chloro-3-phenylpropan-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 114031419 |
| Molecular Formula | C13H13ClN2OS |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-(1-chloro-3-phenylpropan-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC(CCl)Cc1ccccc1)c1cncs1 |
| InChI | InChI=1S/C13H13ClN2OS/c14-7-11(6-10-4-2-1-3-5-10)16-13(17)12-8-15-9-18-12/h1-5,8-9,11H,6-7H2,(H,16,17) |
| InChIKey | QEDXEBWYZJZCPZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|