About 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea
1-methyl-1-(1,3-thiazole-5-carbonylamino)urea (PubChem CID 130710603) has the molecular formula C6H8N4O2S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea.
Molecular Properties
| Compound Name | 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea |
| PubChem CID | 130710603 |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea |
| SMILES | CN(NC(=O)c1cncs1)C(N)=O |
| InChI | InChI=1S/C6H8N4O2S/c1-10(6(7)12)9-5(11)4-2-8-3-13-4/h2-3H,1H3,(H2,7,12)(H,9,11) |
| InChIKey | NMMRLYOQFVOXRY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea?
The IUPAC name of 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea (CID 130710603) is 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea.
What is the SMILES notation for 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea?
The canonical SMILES for 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea is CN(NC(=O)c1cncs1)C(N)=O.
What is the InChIKey of 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea?
The InChIKey is NMMRLYOQFVOXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2S/c1-10(6(7)12)9-5(11)4-2-8-3-13-4/h2-3H,1H3,(H2,7,12)(H,9,11).
What are the key properties of 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea?
1-methyl-1-(1,3-thiazole-5-carbonylamino)urea has a molecular weight of 200.22 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea is sourced from PubChem (CID 130710603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).