C6H8N4O2S — CID 130710603
1-methyl-1-(1,3-thiazole-5-carbonylamino)urea (PubChem CID 130710603) has the molecular formula C6H8N4O2S and a molecular weight of 200.22 g/mol. Its IUPAC name is 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea.
| Compound Name | 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea |
|---|---|
| PubChem CID | 130710603 |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-methyl-1-(1,3-thiazole-5-carbonylamino)urea |
| SMILES | CN(NC(=O)c1cncs1)C(N)=O |
| InChI | InChI=1S/C6H8N4O2S/c1-10(6(7)12)9-5(11)4-2-8-3-13-4/h2-3H,1H3,(H2,7,12)(H,9,11) |
| InChIKey | NMMRLYOQFVOXRY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|