C5H8N2O4S2 — CID 174614259
methanesulfonic acid;1,3-thiazole-5-carboxamide (PubChem CID 174614259) has the molecular formula C5H8N2O4S2 and a molecular weight of 224.26 g/mol. Its IUPAC name is methanesulfonic acid;1,3-thiazole-5-carboxamide.
| Compound Name | methanesulfonic acid;1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 174614259 |
| Molecular Formula | C5H8N2O4S2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | methanesulfonic acid;1,3-thiazole-5-carboxamide |
| SMILES | CS(=O)(=O)O.NC(=O)c1cncs1 |
| InChI | InChI=1S/C4H4N2OS.CH4O3S/c5-4(7)3-1-6-2-8-3;1-5(2,3)4/h1-2H,(H2,5,7);1H3,(H,2,3,4) |
| InChIKey | MKQOYMLGLYQSTC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|