C5H4N2O3S — CID 175264955
carbamoyl 1,3-thiazole-5-carboxylate (PubChem CID 175264955) has the molecular formula C5H4N2O3S and a molecular weight of 172.17 g/mol. Its IUPAC name is carbamoyl 1,3-thiazole-5-carboxylate.
| Compound Name | carbamoyl 1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 175264955 |
| Molecular Formula | C5H4N2O3S |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | carbamoyl 1,3-thiazole-5-carboxylate |
| SMILES | NC(=O)OC(=O)c1cncs1 |
| InChI | InChI=1S/C5H4N2O3S/c6-5(9)10-4(8)3-1-7-2-11-3/h1-2H,(H2,6,9) |
| InChIKey | PTNQYDXTTQGLCW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|