C4H2LiNO2S — CID 67211399
lithium 1,3-thiazole-5-carboxylate (PubChem CID 67211399) has the molecular formula C4H2LiNO2S and a molecular weight of 135.07 g/mol. Its IUPAC name is lithium 1,3-thiazole-5-carboxylate.
| Compound Name | lithium 1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 67211399 |
| Molecular Formula | C4H2LiNO2S |
| Molecular Weight | 135.07 g/mol |
| Exact Mass | 135.00 |
| IUPAC Name | lithium 1,3-thiazole-5-carboxylate |
| SMILES | O=C([O-])c1cncs1.[Li+] |
| InChI | InChI=1S/C4H3NO2S.Li/c6-4(7)3-1-5-2-8-3;/h1-2H,(H,6,7);/q;+1/p-1 |
| InChIKey | FTALESKTZDHVLZ-UHFFFAOYSA-M |
| XLogP | -3.49 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.07 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |