C11H16N2O3S — CID 103822380
tert-butyl (2S)-2-(1,3-thiazole-5-carbonylamino)propanoate (PubChem CID 103822380) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,3-thiazole-5-carbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-2-(1,3-thiazole-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 103822380 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | tert-butyl (2S)-2-(1,3-thiazole-5-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1cncs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16N2O3S/c1-7(10(15)16-11(2,3)4)13-9(14)8-5-12-6-17-8/h5-7H,1-4H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | ZGLQFOYCPXKETG-ZETCQYMHSA-N |
| XLogP | 1.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |