C14H18INO4 — CID 103873822
tert-butyl (2R)-2-[(2-hydroxy-5-iodobenzoyl)amino]propanoate (PubChem CID 103873822) has the molecular formula C14H18INO4 and a molecular weight of 391.21 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-hydroxy-5-iodobenzoyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2-hydroxy-5-iodobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103873822 |
| Molecular Formula | C14H18INO4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | tert-butyl (2R)-2-[(2-hydroxy-5-iodobenzoyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)c1cc(I)ccc1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18INO4/c1-8(13(19)20-14(2,3)4)16-12(18)10-7-9(15)5-6-11(10)17/h5-8,17H,1-4H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | ZHOLRQFOBDYDRD-MRVPVSSYSA-N |
| XLogP | 2.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|