C15H20FNO3 — CID 81003388
tert-butyl (2R)-2-[(5-fluoro-2-methylbenzoyl)amino]propanoate (PubChem CID 81003388) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(5-fluoro-2-methylbenzoyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(5-fluoro-2-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 81003388 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl (2R)-2-[(5-fluoro-2-methylbenzoyl)amino]propanoate |
| SMILES | Cc1ccc(F)cc1C(=O)N[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20FNO3/c1-9-6-7-11(16)8-12(9)13(18)17-10(2)14(19)20-15(3,4)5/h6-8,10H,1-5H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | CTIJVZZNEXZDTL-SNVBAGLBSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |