C13H16F2N2O3 — CID 107470506
tert-butyl (2S)-2-[(2,3-difluoropyridine-4-carbonyl)amino]propanoate (PubChem CID 107470506) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,3-difluoropyridine-4-carbonyl)amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2,3-difluoropyridine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 107470506 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | tert-butyl (2S)-2-[(2,3-difluoropyridine-4-carbonyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccnc(F)c1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H16F2N2O3/c1-7(12(19)20-13(2,3)4)17-11(18)8-5-6-16-10(15)9(8)14/h5-7H,1-4H3,(H,17,18)/t7-/m0/s1 |
| InChIKey | GTHAEODJGLCELA-ZETCQYMHSA-N |
| XLogP | 1.82 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|