C12H16F2N2O — CID 91636239
N-(3,3-dimethylbutan-2-yl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 91636239) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 91636239 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C12H16F2N2O/c1-7(12(2,3)4)16-11(17)8-5-6-15-10(14)9(8)13/h5-7H,1-4H3,(H,16,17) |
| InChIKey | PBBATDZEGATSFY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|