C12H19FN4O — CID 105388598
N-(3,3-dimethylbutan-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388598) has the molecular formula C12H19FN4O and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388598 |
| Molecular Formula | C12H19FN4O |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc(NN)c1F)C(C)(C)C |
| InChI | InChI=1S/C12H19FN4O/c1-7(12(2,3)4)16-11(18)8-5-6-15-10(17-14)9(8)13/h5-7H,14H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | LOBDSDPLDHGXIP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|